C21H27NO5S — CID 58143792
5-methyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethyl]chromen-2-one (PubChem CID 58143792) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-methyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethyl]chromen-2-one.
| Compound Name | 5-methyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethyl]chromen-2-one |
|---|---|
| PubChem CID | 58143792 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-methyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethyl]chromen-2-one |
| SMILES | Cc1c(CC(=O)N2CCC(CS(=O)(=O)C(C)C)CC2)ccc2oc(=O)ccc12 |
| InChI | InChI=1S/C21H27NO5S/c1-14(2)28(25,26)13-16-8-10-22(11-9-16)20(23)12-17-4-6-19-18(15(17)3)5-7-21(24)27-19/h4-7,14,16H,8-13H2,1-3H3 |
| InChIKey | CGBLKTRXTPBHDV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|