C25H40O3S — CID 159200457
1-cyclopentyloxy-2-ethyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]benzene (PubChem CID 159200457) has the molecular formula C25H40O3S and a molecular weight of 420.66 g/mol. Its IUPAC name is 1-cyclopentyloxy-2-ethyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]benzene.
| Compound Name | 1-cyclopentyloxy-2-ethyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 159200457 |
| Molecular Formula | C25H40O3S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-cyclopentyloxy-2-ethyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]benzene |
| SMILES | CCc1cc(CCC2CCC(CS(=O)(=O)C(C)C)CC2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C25H40O3S/c1-4-23-17-21(15-16-25(23)28-24-7-5-6-8-24)12-9-20-10-13-22(14-11-20)18-29(26,27)19(2)3/h15-17,19-20,22,24H,4-14,18H2,1-3H3 |
| InChIKey | DMOPPRDODTWXJO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |