C24H34N2O3S — CID 70939912
N-[4-[(4-cyclopentyloxy-3-ethylanilino)methyl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939912) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is N-[4-[(4-cyclopentyloxy-3-ethylanilino)methyl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[(4-cyclopentyloxy-3-ethylanilino)methyl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70939912 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[4-[(4-cyclopentyloxy-3-ethylanilino)methyl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | CCc1cc(NCc2ccc(NS(=O)(=O)C(C)(C)C)cc2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C24H34N2O3S/c1-5-19-16-21(14-15-23(19)29-22-8-6-7-9-22)25-17-18-10-12-20(13-11-18)26-30(27,28)24(2,3)4/h10-16,22,25-26H,5-9,17H2,1-4H3 |
| InChIKey | CYCUTTDKUCLJKZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|