C20H25NO — CID 39405460
N-[(2-cyclopentyloxyphenyl)methyl]-3,4-dimethylaniline (PubChem CID 39405460) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[(2-cyclopentyloxyphenyl)methyl]-3,4-dimethylaniline.
| Compound Name | N-[(2-cyclopentyloxyphenyl)methyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 39405460 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[(2-cyclopentyloxyphenyl)methyl]-3,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2ccccc2OC2CCCC2)cc1C |
| InChI | InChI=1S/C20H25NO/c1-15-11-12-18(13-16(15)2)21-14-17-7-3-6-10-20(17)22-19-8-4-5-9-19/h3,6-7,10-13,19,21H,4-5,8-9,14H2,1-2H3 |
| InChIKey | WNZAGONRGDPIRB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |