C20H28N2O2S2 — CID 70938861
N-[4-[(4-thiophen-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70938861) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[4-[(4-thiophen-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[(4-thiophen-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938861 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[4-[(4-thiophen-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2ccc(-c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C20H28N2O2S2/c1-15(2)26(23,24)22-19-9-5-16(6-10-19)14-21-18-11-7-17(8-12-18)20-4-3-13-25-20/h3-4,7-8,11-13,15-16,19,21-22H,5-6,9-10,14H2,1-2H3 |
| InChIKey | DPOVOWDGYFHSPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |