C21H36N2O3S — CID 70939474
N-[4-[(4-butoxyanilino)methyl]cyclohexyl]butane-2-sulfonamide (PubChem CID 70939474) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is N-[4-[(4-butoxyanilino)methyl]cyclohexyl]butane-2-sulfonamide.
| Compound Name | N-[4-[(4-butoxyanilino)methyl]cyclohexyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 70939474 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-[4-[(4-butoxyanilino)methyl]cyclohexyl]butane-2-sulfonamide |
| SMILES | CCCCOc1ccc(NCC2CCC(NS(=O)(=O)C(C)CC)CC2)cc1 |
| InChI | InChI=1S/C21H36N2O3S/c1-4-6-15-26-21-13-11-19(12-14-21)22-16-18-7-9-20(10-8-18)23-27(24,25)17(3)5-2/h11-14,17-18,20,22-23H,4-10,15-16H2,1-3H3 |
| InChIKey | TXMUUAQQTOEZBI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|