C19H29N3O3S — CID 70938968
N-[4-[[3-(cyanomethoxy)anilino]methyl]cyclohexyl]butane-2-sulfonamide (PubChem CID 70938968) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[4-[[3-(cyanomethoxy)anilino]methyl]cyclohexyl]butane-2-sulfonamide.
| Compound Name | N-[4-[[3-(cyanomethoxy)anilino]methyl]cyclohexyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 70938968 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[4-[[3-(cyanomethoxy)anilino]methyl]cyclohexyl]butane-2-sulfonamide |
| SMILES | CCC(C)S(=O)(=O)NC1CCC(CNc2cccc(OCC#N)c2)CC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-3-15(2)26(23,24)22-17-9-7-16(8-10-17)14-21-18-5-4-6-19(13-18)25-12-11-20/h4-6,13,15-17,21-22H,3,7-10,12,14H2,1-2H3 |
| InChIKey | YKQDULKDDSIBMW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |