C17H26N4O2S — CID 70939655
N-[4-[(1H-indazol-5-ylamino)methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70939655) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is N-[4-[(1H-indazol-5-ylamino)methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[(1H-indazol-5-ylamino)methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939655 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[4-[(1H-indazol-5-ylamino)methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-12(2)24(22,23)21-15-5-3-13(4-6-15)10-18-16-7-8-17-14(9-16)11-19-20-17/h7-9,11-13,15,18,21H,3-6,10H2,1-2H3,(H,19,20) |
| InChIKey | LZLOKSCNASWUEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |