C11H12BrF3N2O3 — CID 21446419
3-[3-(2-bromo-1,1,2-trifluoroethoxy)phenyl]-1-methoxy-1-methylurea (PubChem CID 21446419) has the molecular formula C11H12BrF3N2O3 and a molecular weight of 357.13 g/mol. Its IUPAC name is 3-[3-(2-bromo-1,1,2-trifluoroethoxy)phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[3-(2-bromo-1,1,2-trifluoroethoxy)phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 21446419 |
| Molecular Formula | C11H12BrF3N2O3 |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 3-[3-(2-bromo-1,1,2-trifluoroethoxy)phenyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1cccc(OC(F)(F)C(F)Br)c1 |
| InChI | InChI=1S/C11H12BrF3N2O3/c1-17(19-2)10(18)16-7-4-3-5-8(6-7)20-11(14,15)9(12)13/h3-6,9H,1-2H3,(H,16,18) |
| InChIKey | YSEQPBHQXZLEOZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|