C11H15ClN2O3 — CID 54473679
3-[3-(2-chloroethoxy)phenyl]-1-methoxy-1-methylurea (PubChem CID 54473679) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-[3-(2-chloroethoxy)phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[3-(2-chloroethoxy)phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 54473679 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-[3-(2-chloroethoxy)phenyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1cccc(OCCCl)c1 |
| InChI | InChI=1S/C11H15ClN2O3/c1-14(16-2)11(15)13-9-4-3-5-10(8-9)17-7-6-12/h3-5,8H,6-7H2,1-2H3,(H,13,15) |
| InChIKey | XKBGHUZIBUWQKH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|