C17H18Cl2N2O4 — CID 12801927
3-[3-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]-1-methoxy-1-methylurea (PubChem CID 12801927) has the molecular formula C17H18Cl2N2O4 and a molecular weight of 385.25 g/mol. Its IUPAC name is 3-[3-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[3-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 12801927 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 3-[3-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1cccc(OCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O4/c1-21(23-2)17(22)20-13-4-3-5-14(11-13)24-8-9-25-16-7-6-12(18)10-15(16)19/h3-7,10-11H,8-9H2,1-2H3,(H,20,22) |
| InChIKey | PXNFHIXFKGKHRA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|