C12H15ClN2S2 — CID 12783490
N-(3-chlorophenyl)-2-ethyl-1,3-thiazolidine-3-carbothioamide (PubChem CID 12783490) has the molecular formula C12H15ClN2S2 and a molecular weight of 286.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-ethyl-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-2-ethyl-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 12783490 |
| Molecular Formula | C12H15ClN2S2 |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-ethyl-1,3-thiazolidine-3-carbothioamide |
| SMILES | CCC1SCCN1C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2S2/c1-2-11-15(6-7-17-11)12(16)14-10-5-3-4-9(13)8-10/h3-5,8,11H,2,6-7H2,1H3,(H,14,16) |
| InChIKey | OMFRAGQXRDPAMI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|