C14H13ClN2S3 — CID 778002
(2R)-N-(4-chlorophenyl)-2-thiophen-2-yl-1,3-thiazolidine-3-carbothioamide (PubChem CID 778002) has the molecular formula C14H13ClN2S3 and a molecular weight of 340.93 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-thiophen-2-yl-1,3-thiazolidine-3-carbothioamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-thiophen-2-yl-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 778002 |
| Molecular Formula | C14H13ClN2S3 |
| Molecular Weight | 340.93 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-thiophen-2-yl-1,3-thiazolidine-3-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCS[C@@H]1c1cccs1 |
| InChI | InChI=1S/C14H13ClN2S3/c15-10-3-5-11(6-4-10)16-14(18)17-7-9-20-13(17)12-2-1-8-19-12/h1-6,8,13H,7,9H2,(H,16,18)/t13-/m1/s1 |
| InChIKey | HLQMQYSIQMQHLL-CYBMUJFWSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|