C16H13Cl2FN2S2 — CID 4766744
2-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 4766744) has the molecular formula C16H13Cl2FN2S2 and a molecular weight of 387.33 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 4766744 |
| Molecular Formula | C16H13Cl2FN2S2 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCSC2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13Cl2FN2S2/c17-13-6-1-10(9-14(13)18)15-21(7-8-23-15)16(22)20-12-4-2-11(19)3-5-12/h1-6,9,15H,7-8H2,(H,20,22) |
| InChIKey | RNBUUCMQCORKNL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|