C24H21Cl2F2N3S — CID 4986062
4-[bis(4-fluorophenyl)methyl]-N-(3,4-dichlorophenyl)piperazine-1-carbothioamide (PubChem CID 4986062) has the molecular formula C24H21Cl2F2N3S and a molecular weight of 492.42 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-N-(3,4-dichlorophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-N-(3,4-dichlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4986062 |
| Molecular Formula | C24H21Cl2F2N3S |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-N-(3,4-dichlorophenyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)N2CCN(C(=S)Nc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C24H21Cl2F2N3S/c25-21-10-9-20(15-22(21)26)29-24(32)31-13-11-30(12-14-31)23(16-1-5-18(27)6-2-16)17-3-7-19(28)8-4-17/h1-10,15,23H,11-14H2,(H,29,32) |
| InChIKey | DQIYDJOWMZUUCM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|