C24H22ClF2N3S — CID 17312784
4-[bis(4-fluorophenyl)methyl]-N-(2-chlorophenyl)piperazine-1-carbothioamide (PubChem CID 17312784) has the molecular formula C24H22ClF2N3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-N-(2-chlorophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-N-(2-chlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17312784 |
| Molecular Formula | C24H22ClF2N3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-N-(2-chlorophenyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)N2CCN(C(=S)Nc3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H22ClF2N3S/c25-21-3-1-2-4-22(21)28-24(31)30-15-13-29(14-16-30)23(17-5-9-19(26)10-6-17)18-7-11-20(27)12-8-18/h1-12,23H,13-16H2,(H,28,31) |
| InChIKey | UPHCMBBSCSXPQG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|