C13H18ClN3S — CID 23818759
N-(2-chlorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide (PubChem CID 23818759) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 23818759 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-(2-chlorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide |
| SMILES | CN1CCCN(C(=S)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C13H18ClN3S/c1-16-7-4-8-17(10-9-16)13(18)15-12-6-3-2-5-11(12)14/h2-3,5-6H,4,7-10H2,1H3,(H,15,18) |
| InChIKey | UCDLXMYZVOWRRO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|