C13H18FN3S — CID 8624615
N-(4-fluorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide (PubChem CID 8624615) has the molecular formula C13H18FN3S and a molecular weight of 267.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide.
| Compound Name | N-(4-fluorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 8624615 |
| Molecular Formula | C13H18FN3S |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-(4-fluorophenyl)-4-methyl-1,4-diazepane-1-carbothioamide |
| SMILES | CN1CCCN(C(=S)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H18FN3S/c1-16-7-2-8-17(10-9-16)13(18)15-12-5-3-11(14)4-6-12/h3-6H,2,7-10H2,1H3,(H,15,18) |
| InChIKey | AOWSNJQBOIXHOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|