C16H13Cl3N2S2 — CID 3381826
N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 3381826) has the molecular formula C16H13Cl3N2S2 and a molecular weight of 403.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 3381826 |
| Molecular Formula | C16H13Cl3N2S2 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCSC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2S2/c17-10-1-4-12(5-2-10)20-16(22)21-7-8-23-15(21)13-6-3-11(18)9-14(13)19/h1-6,9,15H,7-8H2,(H,20,22) |
| InChIKey | RDULVRPMQHZXBP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|