C17H15F3N2OS2 — CID 5235234
N-(4-methoxyphenyl)-2-(2,4,6-trifluorophenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 5235234) has the molecular formula C17H15F3N2OS2 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(2,4,6-trifluorophenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(4-methoxyphenyl)-2-(2,4,6-trifluorophenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 5235234 |
| Molecular Formula | C17H15F3N2OS2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(2,4,6-trifluorophenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCSC2c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H15F3N2OS2/c1-23-12-4-2-11(3-5-12)21-17(24)22-6-7-25-16(22)15-13(19)8-10(18)9-14(15)20/h2-5,8-9,16H,6-7H2,1H3,(H,21,24) |
| InChIKey | CBAAJWXUQMDVRO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|