C17H15ClN4S — CID 66504646
N-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide (PubChem CID 66504646) has the molecular formula C17H15ClN4S and a molecular weight of 342.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 66504646 |
| Molecular Formula | C17H15ClN4S |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1CCCn2c1nc1ccccc12 |
| InChI | InChI=1S/C17H15ClN4S/c18-12-5-3-6-13(11-12)19-17(23)22-10-4-9-21-15-8-2-1-7-14(15)20-16(21)22/h1-3,5-8,11H,4,9-10H2,(H,19,23) |
| InChIKey | BYCXGNKXAFSYMC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|