C14H18N4S2 — CID 7504100
N-(3-methylsulfanylpropyl)-1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbothioamide (PubChem CID 7504100) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbothioamide.
| Compound Name | N-(3-methylsulfanylpropyl)-1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbothioamide |
|---|---|
| PubChem CID | 7504100 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbothioamide |
| SMILES | CSCCCNC(=S)N1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C14H18N4S2/c1-20-10-4-7-15-14(19)18-9-8-17-12-6-3-2-5-11(12)16-13(17)18/h2-3,5-6H,4,7-10H2,1H3,(H,15,19) |
| InChIKey | FCEIFIHXBQWIRU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|