C21H28N5O4- — CID 8015917
(2S)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylbutanoate (PubChem CID 8015917) has the molecular formula C21H28N5O4- and a molecular weight of 414.49 g/mol. Its IUPAC name is (2S)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylbutanoate.
| Compound Name | (2S)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8015917 |
| Molecular Formula | C21H28N5O4- |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (2S)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCNC(=O)N1CCn2c1nc1ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C21H29N5O4/c1-14(2)18(19(28)29)24-17(27)10-4-3-7-11-22-21(30)26-13-12-25-16-9-6-5-8-15(16)23-20(25)26/h5-6,8-9,14,18H,3-4,7,10-13H2,1-2H3,(H,22,30)(H,24,27)(H,28,29)/p-1/t18-/m0/s1 |
| InChIKey | ZXYBFPKQCVGTGC-SFHVURJKSA-M |
| XLogP | 1.02 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|