C22H31N5O4 — CID 40826588
(2S,3R)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylpentanoic acid (PubChem CID 40826588) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S,3R)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 40826588 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (2S,3R)-2-[6-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonylamino)hexanoylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CCCCCNC(=O)N1CCn2c1nc1ccccc12)C(=O)O |
| InChI | InChI=1S/C22H31N5O4/c1-3-15(2)19(20(29)30)25-18(28)11-5-4-8-12-23-22(31)27-14-13-26-17-10-7-6-9-16(17)24-21(26)27/h6-7,9-10,15,19H,3-5,8,11-14H2,1-2H3,(H,23,31)(H,25,28)(H,29,30)/t15-,19+/m1/s1 |
| InChIKey | XCTRPQGBIPSZOQ-BEFAXECRSA-N |
| XLogP | 2.74 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|