C22H29ClN4S — CID 88786603
N-(3-chlorophenyl)-2-[[(1E,7E)-cyclododeca-1,7-dien-1-yl]amino]-4,5-dihydroimidazole-1-carbothioamide (PubChem CID 88786603) has the molecular formula C22H29ClN4S and a molecular weight of 417.02 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[(1E,7E)-cyclododeca-1,7-dien-1-yl]amino]-4,5-dihydroimidazole-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-2-[[(1E,7E)-cyclododeca-1,7-dien-1-yl]amino]-4,5-dihydroimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 88786603 |
| Molecular Formula | C22H29ClN4S |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[(1E,7E)-cyclododeca-1,7-dien-1-yl]amino]-4,5-dihydroimidazole-1-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1CCN=C1N/C1=C/CCCC/C=C/CCCC1 |
| InChI | InChI=1S/C22H29ClN4S/c23-18-11-10-14-20(17-18)26-22(28)27-16-15-24-21(27)25-19-12-8-6-4-2-1-3-5-7-9-13-19/h1-2,10-11,13-14,17H,3-9,12,15-16H2,(H,24,25)(H,26,28)/b2-1+,19-13+ |
| InChIKey | FJGSYLFOXGHHAR-CTWYGFQQSA-N |
| XLogP | 5.87 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|