C15H19ClN4OS2 — CID 20570157
(2E)-N-(3-chlorophenyl)-5-methyl-2-morpholin-4-ylimino-1,3-thiazolidine-3-carbothioamide (PubChem CID 20570157) has the molecular formula C15H19ClN4OS2 and a molecular weight of 370.93 g/mol. Its IUPAC name is (2E)-N-(3-chlorophenyl)-5-methyl-2-morpholin-4-ylimino-1,3-thiazolidine-3-carbothioamide.
| Compound Name | (2E)-N-(3-chlorophenyl)-5-methyl-2-morpholin-4-ylimino-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 20570157 |
| Molecular Formula | C15H19ClN4OS2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (2E)-N-(3-chlorophenyl)-5-methyl-2-morpholin-4-ylimino-1,3-thiazolidine-3-carbothioamide |
| SMILES | CC1CN(C(=S)Nc2cccc(Cl)c2)/C(=N\N2CCOCC2)S1 |
| InChI | InChI=1S/C15H19ClN4OS2/c1-11-10-20(14(22)17-13-4-2-3-12(16)9-13)15(23-11)18-19-5-7-21-8-6-19/h2-4,9,11H,5-8,10H2,1H3,(H,17,22)/b18-15+ |
| InChIKey | YHONXVKYBJPADP-OBGWFSINSA-N |
| XLogP | 3.08 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|