C13H15ClN2O3 — CID 108943524
N-(3-chlorophenyl)-3-morpholin-4-yl-3-oxopropanamide (PubChem CID 108943524) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-morpholin-4-yl-3-oxopropanamide.
| Compound Name | N-(3-chlorophenyl)-3-morpholin-4-yl-3-oxopropanamide |
|---|---|
| PubChem CID | 108943524 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-morpholin-4-yl-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCOCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O3/c14-10-2-1-3-11(8-10)15-12(17)9-13(18)16-4-6-19-7-5-16/h1-3,8H,4-7,9H2,(H,15,17) |
| InChIKey | XRXSNIMJSLHQTH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|