C19H27ClN4O3 — CID 8774686
(2S)-N-(3-chlorophenyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]propanamide (PubChem CID 8774686) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8774686 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(Cl)c1)N1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H27ClN4O3/c1-15(19(26)21-17-4-2-3-16(20)13-17)23-7-5-22(6-8-23)14-18(25)24-9-11-27-12-10-24/h2-4,13,15H,5-12,14H2,1H3,(H,21,26)/t15-/m0/s1 |
| InChIKey | UUGNCHGRJLDBKC-HNNXBMFYSA-N |
| XLogP | 1.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |