C18H25FN4S2 — CID 20570141
(2Z)-2-(4-ethylpiperidin-1-yl)imino-N-(3-fluorophenyl)-5-methyl-1,3-thiazolidine-3-carbothioamide (PubChem CID 20570141) has the molecular formula C18H25FN4S2 and a molecular weight of 380.56 g/mol. Its IUPAC name is (2Z)-2-(4-ethylpiperidin-1-yl)imino-N-(3-fluorophenyl)-5-methyl-1,3-thiazolidine-3-carbothioamide.
| Compound Name | (2Z)-2-(4-ethylpiperidin-1-yl)imino-N-(3-fluorophenyl)-5-methyl-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 20570141 |
| Molecular Formula | C18H25FN4S2 |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2Z)-2-(4-ethylpiperidin-1-yl)imino-N-(3-fluorophenyl)-5-methyl-1,3-thiazolidine-3-carbothioamide |
| SMILES | CCC1CCN(/N=C2\SC(C)CN2C(=S)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H25FN4S2/c1-3-14-7-9-22(10-8-14)21-18-23(12-13(2)25-18)17(24)20-16-6-4-5-15(19)11-16/h4-6,11,13-14H,3,7-10,12H2,1-2H3,(H,20,24)/b21-18- |
| InChIKey | ORHXIBFLZDBXRH-UZYVYHOESA-N |
| XLogP | 4.35 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|