C16H16ClN3S3 — CID 88763914
N-(3-chlorophenyl)-5-methyl-2-(2-methylthiophen-3-yl)imino-1,3-thiazolidine-3-carbothioamide (PubChem CID 88763914) has the molecular formula C16H16ClN3S3 and a molecular weight of 381.98 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-methyl-2-(2-methylthiophen-3-yl)imino-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-5-methyl-2-(2-methylthiophen-3-yl)imino-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 88763914 |
| Molecular Formula | C16H16ClN3S3 |
| Molecular Weight | 381.98 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-(3-chlorophenyl)-5-methyl-2-(2-methylthiophen-3-yl)imino-1,3-thiazolidine-3-carbothioamide |
| SMILES | Cc1sccc1/N=C1\SC(C)CN1C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3S3/c1-10-9-20(15(21)18-13-5-3-4-12(17)8-13)16(23-10)19-14-6-7-22-11(14)2/h3-8,10H,9H2,1-2H3,(H,18,21)/b19-16- |
| InChIKey | CRMMIGSMIWENPY-MNDPQUGUSA-N |
| XLogP | 5.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|