C18H15ClF3N3OS — CID 1116150
(5R)-2-(2-chlorophenyl)imino-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carboxamide (PubChem CID 1116150) has the molecular formula C18H15ClF3N3OS and a molecular weight of 413.85 g/mol. Its IUPAC name is (5R)-2-(2-chlorophenyl)imino-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carboxamide.
| Compound Name | (5R)-2-(2-chlorophenyl)imino-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 1116150 |
| Molecular Formula | C18H15ClF3N3OS |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (5R)-2-(2-chlorophenyl)imino-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2cccc(C(F)(F)F)c2)/C(=N/c2ccccc2Cl)S1 |
| InChI | InChI=1S/C18H15ClF3N3OS/c1-11-10-25(17(27-11)24-15-8-3-2-7-14(15)19)16(26)23-13-6-4-5-12(9-13)18(20,21)22/h2-9,11H,10H2,1H3,(H,23,26)/b24-17-/t11-/m1/s1 |
| InChIKey | HMVIHNSJTYAPEO-CFLRLNCXSA-N |
| XLogP | 6.02 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|