C19H27BrN4S2 — CID 20570102
N-(3-bromophenyl)-2-[2-(2,3-dimethylpiperidin-1-yl)ethylimino]-1,3-thiazolidine-3-carbothioamide (PubChem CID 20570102) has the molecular formula C19H27BrN4S2 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-(2,3-dimethylpiperidin-1-yl)ethylimino]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-bromophenyl)-2-[2-(2,3-dimethylpiperidin-1-yl)ethylimino]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 20570102 |
| Molecular Formula | C19H27BrN4S2 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-(2,3-dimethylpiperidin-1-yl)ethylimino]-1,3-thiazolidine-3-carbothioamide |
| SMILES | CC1CCCN(CC/N=C2\SCCN2C(=S)Nc2cccc(Br)c2)C1C |
| InChI | InChI=1S/C19H27BrN4S2/c1-14-5-4-9-23(15(14)2)10-8-21-19-24(11-12-26-19)18(25)22-17-7-3-6-16(20)13-17/h3,6-7,13-15H,4-5,8-12H2,1-2H3,(H,22,25)/b21-19- |
| InChIKey | RGUNVRXOSCYNMW-VZCXRCSSSA-N |
| XLogP | 4.67 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|