C29H28Cl2N4S4 — CID 20570109
2-[3-(2-chloro-4-cyano-5-methylsulfanylphenyl)-2-(4-ethylsulfanylphenyl)propyl]imino-N-(3-chlorophenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 20570109) has the molecular formula C29H28Cl2N4S4 and a molecular weight of 631.75 g/mol. Its IUPAC name is 2-[3-(2-chloro-4-cyano-5-methylsulfanylphenyl)-2-(4-ethylsulfanylphenyl)propyl]imino-N-(3-chlorophenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-[3-(2-chloro-4-cyano-5-methylsulfanylphenyl)-2-(4-ethylsulfanylphenyl)propyl]imino-N-(3-chlorophenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 20570109 |
| Molecular Formula | C29H28Cl2N4S4 |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | 2-[3-(2-chloro-4-cyano-5-methylsulfanylphenyl)-2-(4-ethylsulfanylphenyl)propyl]imino-N-(3-chlorophenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | CCSc1ccc(C(C/N=C2\SCCN2C(=S)Nc2cccc(Cl)c2)Cc2cc(SC)c(C#N)cc2Cl)cc1 |
| InChI | InChI=1S/C29H28Cl2N4S4/c1-3-38-25-9-7-19(8-10-25)22(13-20-15-27(37-2)21(17-32)14-26(20)31)18-33-29-35(11-12-39-29)28(36)34-24-6-4-5-23(30)16-24/h4-10,14-16,22H,3,11-13,18H2,1-2H3,(H,34,36)/b33-29- |
| InChIKey | UEKQLEWIQABHCE-IYOYZZHUSA-N |
| XLogP | 8.83 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|