C20H28ClN3OS — CID 4230775
1-(1-acetylpiperidin-4-yl)-3-(3-chlorophenyl)-1-cyclohexylthiourea (PubChem CID 4230775) has the molecular formula C20H28ClN3OS and a molecular weight of 393.98 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(3-chlorophenyl)-1-cyclohexylthiourea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(3-chlorophenyl)-1-cyclohexylthiourea |
|---|---|
| PubChem CID | 4230775 |
| Molecular Formula | C20H28ClN3OS |
| Molecular Weight | 393.98 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(3-chlorophenyl)-1-cyclohexylthiourea |
| SMILES | CC(=O)N1CCC(N(C(=S)Nc2cccc(Cl)c2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H28ClN3OS/c1-15(25)23-12-10-19(11-13-23)24(18-8-3-2-4-9-18)20(26)22-17-7-5-6-16(21)14-17/h5-7,14,18-19H,2-4,8-13H2,1H3,(H,22,26) |
| InChIKey | GRUZDVNDLDDBPS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|