C22H25N3OS2 — CID 143349246
S-methyl 2-(4-cyanonaphthalen-1-yl)imino-1-thia-3-azacycloundecane-3-carbothioate (PubChem CID 143349246) has the molecular formula C22H25N3OS2 and a molecular weight of 411.60 g/mol. Its IUPAC name is S-methyl 2-(4-cyanonaphthalen-1-yl)imino-1-thia-3-azacycloundecane-3-carbothioate.
| Compound Name | S-methyl 2-(4-cyanonaphthalen-1-yl)imino-1-thia-3-azacycloundecane-3-carbothioate |
|---|---|
| PubChem CID | 143349246 |
| Molecular Formula | C22H25N3OS2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | S-methyl 2-(4-cyanonaphthalen-1-yl)imino-1-thia-3-azacycloundecane-3-carbothioate |
| SMILES | CSC(=O)N1CCCCCCCCS/C1=N\c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C22H25N3OS2/c1-27-22(26)25-14-8-4-2-3-5-9-15-28-21(25)24-20-13-12-17(16-23)18-10-6-7-11-19(18)20/h6-7,10-13H,2-5,8-9,14-15H2,1H3/b24-21- |
| InChIKey | VAMNKQHCHKEEIQ-FLFQWRMESA-N |
| XLogP | 6.57 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|