C23H30N2OS2 — CID 11973727
S-methyl 5-(2-methylpropyl)-2-naphthalen-1-ylimino-5-propan-2-yl-1,3-thiazinane-3-carbothioate (PubChem CID 11973727) has the molecular formula C23H30N2OS2 and a molecular weight of 414.64 g/mol. Its IUPAC name is S-methyl 5-(2-methylpropyl)-2-naphthalen-1-ylimino-5-propan-2-yl-1,3-thiazinane-3-carbothioate.
| Compound Name | S-methyl 5-(2-methylpropyl)-2-naphthalen-1-ylimino-5-propan-2-yl-1,3-thiazinane-3-carbothioate |
|---|---|
| PubChem CID | 11973727 |
| Molecular Formula | C23H30N2OS2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | S-methyl 5-(2-methylpropyl)-2-naphthalen-1-ylimino-5-propan-2-yl-1,3-thiazinane-3-carbothioate |
| SMILES | CSC(=O)N1CC(CC(C)C)(C(C)C)CS/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C23H30N2OS2/c1-16(2)13-23(17(3)4)14-25(22(26)27-5)21(28-15-23)24-20-12-8-10-18-9-6-7-11-19(18)20/h6-12,16-17H,13-15H2,1-5H3/b24-21- |
| InChIKey | HIDUTJKGXMFZFI-FLFQWRMESA-N |
| XLogP | 7.05 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|