C21H25N3O4S2 — CID 16592442
2-methoxy-5-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 16592442) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-methoxy-5-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-methoxy-5-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 16592442 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-methoxy-5-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(C(=O)N2CCS/C2=N\c2ccccc2C)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C21H25N3O4S2/c1-14(2)23-30(26,27)19-13-16(9-10-18(19)28-4)20(25)24-11-12-29-21(24)22-17-8-6-5-7-15(17)3/h5-10,13-14,23H,11-12H2,1-4H3/b22-21- |
| InChIKey | GWSSGUZFJZAXHA-DQRAZIAOSA-N |
| XLogP | 3.57 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|