C22H27N3O5S — CID 43060412
1-[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]-N-phenylpyrrolidine-2-carboxamide (PubChem CID 43060412) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43060412 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]-N-phenylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCC2C(=O)Nc2ccccc2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C22H27N3O5S/c1-15(2)24-31(28,29)20-14-16(11-12-19(20)30-3)22(27)25-13-7-10-18(25)21(26)23-17-8-5-4-6-9-17/h4-6,8-9,11-12,14-15,18,24H,7,10,13H2,1-3H3,(H,23,26) |
| InChIKey | YYJQTKAVBFGEFK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |