C18H17N3O3S — CID 2123940
(2-benzylimino-1,3-thiazinan-3-yl)-(4-nitrophenyl)methanone (PubChem CID 2123940) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is (2-benzylimino-1,3-thiazinan-3-yl)-(4-nitrophenyl)methanone.
| Compound Name | (2-benzylimino-1,3-thiazinan-3-yl)-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 2123940 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2-benzylimino-1,3-thiazinan-3-yl)-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCCS/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3O3S/c22-17(15-7-9-16(10-8-15)21(23)24)20-11-4-12-25-18(20)19-13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2/b19-18- |
| InChIKey | KQWUNEOKAKHAOI-HNENSFHCSA-N |
| XLogP | 3.73 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|