C19H20ClN3S2 — CID 7873135
(5R)-2-(4-chlorophenyl)imino-5-methyl-N-(2-phenylethyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 7873135) has the molecular formula C19H20ClN3S2 and a molecular weight of 389.98 g/mol. Its IUPAC name is (5R)-2-(4-chlorophenyl)imino-5-methyl-N-(2-phenylethyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | (5R)-2-(4-chlorophenyl)imino-5-methyl-N-(2-phenylethyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 7873135 |
| Molecular Formula | C19H20ClN3S2 |
| Molecular Weight | 389.98 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (5R)-2-(4-chlorophenyl)imino-5-methyl-N-(2-phenylethyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)NCCc2ccccc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C19H20ClN3S2/c1-14-13-23(18(24)21-12-11-15-5-3-2-4-6-15)19(25-14)22-17-9-7-16(20)8-10-17/h2-10,14H,11-13H2,1H3,(H,21,24)/b22-19-/t14-/m1/s1 |
| InChIKey | WXXQXDMLDNPZES-CINSFREOSA-N |
| XLogP | 4.88 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|