C20H22N2O3S2 — CID 8895471
[(5R)-5-methyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-[3-(methylsulfonylmethyl)phenyl]methanone (PubChem CID 8895471) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is [(5R)-5-methyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-[3-(methylsulfonylmethyl)phenyl]methanone.
| Compound Name | [(5R)-5-methyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-[3-(methylsulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 8895471 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [(5R)-5-methyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-[3-(methylsulfonylmethyl)phenyl]methanone |
| SMILES | Cc1cccc(/N=C2\S[C@H](C)CN2C(=O)c2cccc(CS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-14-6-4-9-18(10-14)21-20-22(12-15(2)26-20)19(23)17-8-5-7-16(11-17)13-27(3,24)25/h4-11,15H,12-13H2,1-3H3/b21-20-/t15-/m1/s1 |
| InChIKey | SKAGANWJNFOKFW-MSVBSMQLSA-N |
| XLogP | 3.80 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|