C15H22N2O3 — CID 79410179
1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one (PubChem CID 79410179) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one.
| Compound Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 79410179 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one |
| SMILES | CN(C)c1ccc(CCC(=O)N2C[C@@H](O)[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-16(2)12-6-3-11(4-7-12)5-8-15(20)17-9-13(18)14(19)10-17/h3-4,6-7,13-14,18-19H,5,8-10H2,1-2H3/t13-,14+ |
| InChIKey | YIYKEJDLVSSFEQ-OKILXGFUSA-N |
| XLogP | 0.25 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|