C16H25N3O3S — CID 118795576
[1-[3-[4-(dimethylamino)phenyl]propanoyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 118795576) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is [1-[3-[4-(dimethylamino)phenyl]propanoyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[3-[4-(dimethylamino)phenyl]propanoyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 118795576 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [1-[3-[4-(dimethylamino)phenyl]propanoyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CN(C)c1ccc(CCC(=O)N2CCC(CS(N)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-18(2)15-6-3-13(4-7-15)5-8-16(20)19-10-9-14(11-19)12-23(17,21)22/h3-4,6-7,14H,5,8-12H2,1-2H3,(H2,17,21,22) |
| InChIKey | JNDVRDFHBPHICV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|