C13H16ClN3OS — CID 135672718
5-(4-chlorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135672718) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(4-chlorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135672718 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COC[C@@H](C)/N=C1/NN=C(c2ccc(Cl)cc2)CS1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-9(7-18-2)15-13-17-16-12(8-19-13)10-3-5-11(14)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | MWESGUVXPZJMKF-SECBINFHSA-N |
| XLogP | 2.77 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|