C14H18N4OS — CID 135673041
N-[4-(2-propylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide (PubChem CID 135673041) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[4-(2-propylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide.
| Compound Name | N-[4-(2-propylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135673041 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[4-(2-propylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide |
| SMILES | CCC/N=C1/NN=C(c2ccc(NC(C)=O)cc2)CS1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-8-15-14-18-17-13(9-20-14)11-4-6-12(7-5-11)16-10(2)19/h4-7H,3,8-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | OCYAIZQYOVDFMQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|