C18H26N5O2S+ — CID 135828350
N-[4-[2-(2-morpholin-4-ium-4-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide (PubChem CID 135828350) has the molecular formula C18H26N5O2S+ and a molecular weight of 376.51 g/mol. Its IUPAC name is N-[4-[2-(2-morpholin-4-ium-4-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide.
| Compound Name | N-[4-[2-(2-morpholin-4-ium-4-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 135828350 |
| Molecular Formula | C18H26N5O2S+ |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[4-[2-(2-morpholin-4-ium-4-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C2=NN/C(=N/CC[NH+]3CCOCC3)SC2)cc1 |
| InChI | InChI=1S/C18H25N5O2S/c1-2-17(24)20-15-5-3-14(4-6-15)16-13-26-18(22-21-16)19-7-8-23-9-11-25-12-10-23/h3-6H,2,7-13H2,1H3,(H,19,22)(H,20,24)/p+1 |
| InChIKey | JCTCDTZPFKKLTI-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|