C13H15F2N3OS — CID 135672696
5-(3,4-difluorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135672696) has the molecular formula C13H15F2N3OS and a molecular weight of 299.35 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(3,4-difluorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135672696 |
| Molecular Formula | C13H15F2N3OS |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-(3,4-difluorophenyl)-N-[(2R)-1-methoxypropan-2-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COC[C@@H](C)/N=C1/NN=C(c2ccc(F)c(F)c2)CS1 |
| InChI | InChI=1S/C13H15F2N3OS/c1-8(6-19-2)16-13-18-17-12(7-20-13)9-3-4-10(14)11(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | ZPAPLHUDQICKOY-MRVPVSSYSA-N |
| XLogP | 2.40 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|