C18H23N5OS — CID 158163193
6-[2-(2-piperidin-1-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one (PubChem CID 158163193) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 6-[2-(2-piperidin-1-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one.
| Compound Name | 6-[2-(2-piperidin-1-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 158163193 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-[2-(2-piperidin-1-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(C3=NN/C(=N/CCN4CCCCC4)SC3)cc2N1 |
| InChI | InChI=1S/C18H23N5OS/c24-17-11-14-5-4-13(10-15(14)20-17)16-12-25-18(22-21-16)19-6-9-23-7-2-1-3-8-23/h4-5,10H,1-3,6-9,11-12H2,(H,19,22)(H,20,24) |
| InChIKey | FWNJBPPLCDMESO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|