C17H20N4OS — CID 135483499
5-(2-cyclopentylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1-methyl-3H-indol-2-one (PubChem CID 135483499) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-(2-cyclopentylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(2-cyclopentylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 135483499 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-(2-cyclopentylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C3=NN/C(=N/C4CCCC4)SC3)ccc21 |
| InChI | InChI=1S/C17H20N4OS/c1-21-15-7-6-11(8-12(15)9-16(21)22)14-10-23-17(20-19-14)18-13-4-2-3-5-13/h6-8,13H,2-5,9-10H2,1H3,(H,18,20) |
| InChIKey | NVFXCDBMKMVYNB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|