C16H21BrN4O2S — CID 135903895
N-(2-methylcyclohexyl)-5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide (PubChem CID 135903895) has the molecular formula C16H21BrN4O2S and a molecular weight of 413.34 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide.
| Compound Name | N-(2-methylcyclohexyl)-5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
|---|---|
| PubChem CID | 135903895 |
| Molecular Formula | C16H21BrN4O2S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(2-methylcyclohexyl)-5-(3-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
| SMILES | Br.CC1CCCCC1/N=C1/NN=C(c2cccc([N+](=O)[O-])c2)CS1 |
| InChI | InChI=1S/C16H20N4O2S.BrH/c1-11-5-2-3-8-14(11)17-16-19-18-15(10-23-16)12-6-4-7-13(9-12)20(21)22;/h4,6-7,9,11,14H,2-3,5,8,10H2,1H3,(H,17,19);1H |
| InChIKey | AWPUNAWGGMDYTI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|